C8H13N3 — CID 116932848
1-pyridin-3-ylpropane-1,3-diamine (PubChem CID 116932848) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is 1-pyridin-3-ylpropane-1,3-diamine.
| Compound Name | 1-pyridin-3-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 116932848 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 1-pyridin-3-ylpropane-1,3-diamine |
| SMILES | NCCC(N)c1cccnc1 |
| InChI | InChI=1S/C8H13N3/c9-4-3-8(10)7-2-1-5-11-6-7/h1-2,5-6,8H,3-4,9-10H2 |
| InChIKey | DEPXQXUBHRRYIM-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |