C15H21ClN2 — CID 171220846
(1S)-1-naphthalen-2-ylpentane-1,5-diamine;hydrochloride (PubChem CID 171220846) has the molecular formula C15H21ClN2 and a molecular weight of 264.80 g/mol. Its IUPAC name is (1S)-1-naphthalen-2-ylpentane-1,5-diamine;hydrochloride.
| Compound Name | (1S)-1-naphthalen-2-ylpentane-1,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 171220846 |
| Molecular Formula | C15H21ClN2 |
| Molecular Weight | 264.80 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (1S)-1-naphthalen-2-ylpentane-1,5-diamine;hydrochloride |
| SMILES | Cl.NCCCC[C@H](N)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H20N2.ClH/c16-10-4-3-7-15(17)14-9-8-12-5-1-2-6-13(12)11-14;/h1-2,5-6,8-9,11,15H,3-4,7,10,16-17H2;1H/t15-;/m0./s1 |
| InChIKey | UBMNJUSAYXRVIB-RSAXXLAASA-N |
| XLogP | 3.39 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.80 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|