C20H21N — CID 63416758
1-naphthalen-2-yl-4-phenylbutan-1-amine (PubChem CID 63416758) has the molecular formula C20H21N and a molecular weight of 275.40 g/mol. Its IUPAC name is 1-naphthalen-2-yl-4-phenylbutan-1-amine.
| Compound Name | 1-naphthalen-2-yl-4-phenylbutan-1-amine |
|---|---|
| PubChem CID | 63416758 |
| Molecular Formula | C20H21N |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 1-naphthalen-2-yl-4-phenylbutan-1-amine |
| SMILES | NC(CCCc1ccccc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H21N/c21-20(12-6-9-16-7-2-1-3-8-16)19-14-13-17-10-4-5-11-18(17)15-19/h1-5,7-8,10-11,13-15,20H,6,9,12,21H2 |
| InChIKey | OOIZSPYHUXCTPP-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |