C15H17ClINO — CID 171264272
(1R,2S)-1-amino-1-(3-iodophenyl)-3-phenylpropan-2-ol;hydrochloride (PubChem CID 171264272) has the molecular formula C15H17ClINO and a molecular weight of 389.66 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(3-iodophenyl)-3-phenylpropan-2-ol;hydrochloride.
| Compound Name | (1R,2S)-1-amino-1-(3-iodophenyl)-3-phenylpropan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171264272 |
| Molecular Formula | C15H17ClINO |
| Molecular Weight | 389.66 g/mol |
| Exact Mass | 389.00 |
| IUPAC Name | (1R,2S)-1-amino-1-(3-iodophenyl)-3-phenylpropan-2-ol;hydrochloride |
| SMILES | Cl.N[C@H](c1cccc(I)c1)[C@@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C15H16INO.ClH/c16-13-8-4-7-12(10-13)15(17)14(18)9-11-5-2-1-3-6-11;/h1-8,10,14-15,18H,9,17H2;1H/t14-,15+;/m0./s1 |
| InChIKey | UHVGGUPUGCYYHE-LDXVYITESA-N |
| XLogP | 3.32 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.66 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|