C17H22ClNO2 — CID 171262632
(1R,2S)-1-amino-1-(3-ethoxyphenyl)-3-phenylpropan-2-ol;hydrochloride (PubChem CID 171262632) has the molecular formula C17H22ClNO2 and a molecular weight of 307.82 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(3-ethoxyphenyl)-3-phenylpropan-2-ol;hydrochloride.
| Compound Name | (1R,2S)-1-amino-1-(3-ethoxyphenyl)-3-phenylpropan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171262632 |
| Molecular Formula | C17H22ClNO2 |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | (1R,2S)-1-amino-1-(3-ethoxyphenyl)-3-phenylpropan-2-ol;hydrochloride |
| SMILES | CCOc1cccc([C@@H](N)[C@@H](O)Cc2ccccc2)c1.Cl |
| InChI | InChI=1S/C17H21NO2.ClH/c1-2-20-15-10-6-9-14(12-15)17(18)16(19)11-13-7-4-3-5-8-13;/h3-10,12,16-17,19H,2,11,18H2,1H3;1H/t16-,17+;/m0./s1 |
| InChIKey | PUBGEWLPRBQRBH-MCJVGQIASA-N |
| XLogP | 3.11 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |