C11H18ClNO2 — CID 171268301
(1S,2R)-1-amino-1-(3-ethoxyphenyl)propan-2-ol;hydrochloride (PubChem CID 171268301) has the molecular formula C11H18ClNO2 and a molecular weight of 231.72 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(3-ethoxyphenyl)propan-2-ol;hydrochloride.
| Compound Name | (1S,2R)-1-amino-1-(3-ethoxyphenyl)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171268301 |
| Molecular Formula | C11H18ClNO2 |
| Molecular Weight | 231.72 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | (1S,2R)-1-amino-1-(3-ethoxyphenyl)propan-2-ol;hydrochloride |
| SMILES | CCOc1cccc([C@H](N)[C@@H](C)O)c1.Cl |
| InChI | InChI=1S/C11H17NO2.ClH/c1-3-14-10-6-4-5-9(7-10)11(12)8(2)13;/h4-8,11,13H,3,12H2,1-2H3;1H/t8-,11-;/m1./s1 |
| InChIKey | LSNVWTWNMLLYRZ-JHQAJZDGSA-N |
| XLogP | 1.89 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.72 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |