C13H21NO — CID 94424615
(1S)-1-(3-ethoxyphenyl)-2,2-dimethylpropan-1-amine (PubChem CID 94424615) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (1S)-1-(3-ethoxyphenyl)-2,2-dimethylpropan-1-amine.
| Compound Name | (1S)-1-(3-ethoxyphenyl)-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 94424615 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (1S)-1-(3-ethoxyphenyl)-2,2-dimethylpropan-1-amine |
| SMILES | CCOc1cccc([C@@H](N)C(C)(C)C)c1 |
| InChI | InChI=1S/C13H21NO/c1-5-15-11-8-6-7-10(9-11)12(14)13(2,3)4/h6-9,12H,5,14H2,1-4H3/t12-/m1/s1 |
| InChIKey | VLRWMYCADJMRTD-GFCCVEGCSA-N |
| XLogP | 3.13 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |