C19H26ClNO — CID 171261579
(1R,2S)-1-amino-1-(4-tert-butylphenyl)-3-phenylpropan-2-ol;hydrochloride (PubChem CID 171261579) has the molecular formula C19H26ClNO and a molecular weight of 319.88 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(4-tert-butylphenyl)-3-phenylpropan-2-ol;hydrochloride.
| Compound Name | (1R,2S)-1-amino-1-(4-tert-butylphenyl)-3-phenylpropan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171261579 |
| Molecular Formula | C19H26ClNO |
| Molecular Weight | 319.88 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | (1R,2S)-1-amino-1-(4-tert-butylphenyl)-3-phenylpropan-2-ol;hydrochloride |
| SMILES | CC(C)(C)c1ccc([C@@H](N)[C@@H](O)Cc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C19H25NO.ClH/c1-19(2,3)16-11-9-15(10-12-16)18(20)17(21)13-14-7-5-4-6-8-14;/h4-12,17-18,21H,13,20H2,1-3H3;1H/t17-,18+;/m0./s1 |
| InChIKey | AODBXDVLHKJHLW-CJRXIRLBSA-N |
| XLogP | 4.01 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.88 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |