About 3-phenylpropanoyl 3-amino-3-phenylpropanoate
3-phenylpropanoyl 3-amino-3-phenylpropanoate (PubChem CID 174426810) has the molecular formula C18H19NO3
and a molecular weight of 297.35 g/mol. Its IUPAC name is 3-phenylpropanoyl 3-amino-3-phenylpropanoate.
Molecular Properties
| Compound Name | 3-phenylpropanoyl 3-amino-3-phenylpropanoate |
| PubChem CID | 174426810 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 3-phenylpropanoyl 3-amino-3-phenylpropanoate |
| SMILES | NC(CC(=O)OC(=O)CCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H19NO3/c19-16(15-9-5-2-6-10-15)13-18(21)22-17(20)12-11-14-7-3-1-4-8-14/h1-10,16H,11-13,19H2 |
| InChIKey | NYXODZSYRJFPHH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylpropanoyl 3-amino-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylpropanoyl 3-amino-3-phenylpropanoate?
The IUPAC name of 3-phenylpropanoyl 3-amino-3-phenylpropanoate (CID 174426810) is 3-phenylpropanoyl 3-amino-3-phenylpropanoate.
What is the SMILES notation for 3-phenylpropanoyl 3-amino-3-phenylpropanoate?
The canonical SMILES for 3-phenylpropanoyl 3-amino-3-phenylpropanoate is NC(CC(=O)OC(=O)CCc1ccccc1)c1ccccc1.
What is the InChIKey of 3-phenylpropanoyl 3-amino-3-phenylpropanoate?
The InChIKey is NYXODZSYRJFPHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO3/c19-16(15-9-5-2-6-10-15)13-18(21)22-17(20)12-11-14-7-3-1-4-8-14/h1-10,16H,11-13,19H2.
What are the key properties of 3-phenylpropanoyl 3-amino-3-phenylpropanoate?
3-phenylpropanoyl 3-amino-3-phenylpropanoate has a molecular weight of 297.35 g/mol, XLogP of 2.78, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylpropanoyl 3-amino-3-phenylpropanoate is sourced from PubChem (CID 174426810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).