C11H19N3O2 — CID 70126726
carbamic acid;4-phenylbutane-1,2-diamine (PubChem CID 70126726) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is carbamic acid;4-phenylbutane-1,2-diamine.
| Compound Name | carbamic acid;4-phenylbutane-1,2-diamine |
|---|---|
| PubChem CID | 70126726 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | carbamic acid;4-phenylbutane-1,2-diamine |
| SMILES | NC(=O)O.NCC(N)CCc1ccccc1 |
| InChI | InChI=1S/C10H16N2.CH3NO2/c11-8-10(12)7-6-9-4-2-1-3-5-9;2-1(3)4/h1-5,10H,6-8,11-12H2;2H2,(H,3,4) |
| InChIKey | YPTBRYYCHSLVQG-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 115.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |