C12H20N2 — CID 23163544
6-phenylhexane-1,4-diamine (PubChem CID 23163544) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 6-phenylhexane-1,4-diamine.
| Compound Name | 6-phenylhexane-1,4-diamine |
|---|---|
| PubChem CID | 23163544 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 6-phenylhexane-1,4-diamine |
| SMILES | NCCCC(N)CCc1ccccc1 |
| InChI | InChI=1S/C12H20N2/c13-10-4-7-12(14)9-8-11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10,13-14H2 |
| InChIKey | DXQUIIOVTZCRCE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |