C22H31N3OS2 — CID 57255392
(2R)-2,5-diamino-N-(2-benzylsulfanyl-2-sulfanylethyl)-N-(2-phenylethyl)pentanamide (PubChem CID 57255392) has the molecular formula C22H31N3OS2 and a molecular weight of 417.64 g/mol. Its IUPAC name is (2R)-2,5-diamino-N-(2-benzylsulfanyl-2-sulfanylethyl)-N-(2-phenylethyl)pentanamide.
| Compound Name | (2R)-2,5-diamino-N-(2-benzylsulfanyl-2-sulfanylethyl)-N-(2-phenylethyl)pentanamide |
|---|---|
| PubChem CID | 57255392 |
| Molecular Formula | C22H31N3OS2 |
| Molecular Weight | 417.64 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | (2R)-2,5-diamino-N-(2-benzylsulfanyl-2-sulfanylethyl)-N-(2-phenylethyl)pentanamide |
| SMILES | NCCC[C@@H](N)C(=O)N(CCc1ccccc1)CC(S)SCc1ccccc1 |
| InChI | InChI=1S/C22H31N3OS2/c23-14-7-12-20(24)22(26)25(15-13-18-8-3-1-4-9-18)16-21(27)28-17-19-10-5-2-6-11-19/h1-6,8-11,20-21,27H,7,12-17,23-24H2/t20-,21?/m1/s1 |
| InChIKey | DSRRBXGZBPMNRA-VQCQRNETSA-N |
| XLogP | 3.31 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.64 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|