C13H16N2O6 — CID 22820845
(2S)-2-[3-aminopropanoyl(phenylmethoxycarbonyl)amino]-2-hydroxyacetic acid (PubChem CID 22820845) has the molecular formula C13H16N2O6 and a molecular weight of 296.28 g/mol. Its IUPAC name is (2S)-2-[3-aminopropanoyl(phenylmethoxycarbonyl)amino]-2-hydroxyacetic acid.
| Compound Name | (2S)-2-[3-aminopropanoyl(phenylmethoxycarbonyl)amino]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 22820845 |
| Molecular Formula | C13H16N2O6 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | (2S)-2-[3-aminopropanoyl(phenylmethoxycarbonyl)amino]-2-hydroxyacetic acid |
| SMILES | NCCC(=O)N(C(=O)OCc1ccccc1)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C13H16N2O6/c14-7-6-10(16)15(11(17)12(18)19)13(20)21-8-9-4-2-1-3-5-9/h1-5,11,17H,6-8,14H2,(H,18,19)/t11-/m0/s1 |
| InChIKey | BJYYWKBRXQLRSO-NSHDSACASA-N |
| XLogP | -0.10 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|