C22H28N2O3 — CID 57133848
benzyl N-(2-amino-3,3-dimethylbutanoyl)-N-[(1S)-1-phenylethyl]carbamate (PubChem CID 57133848) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is benzyl N-(2-amino-3,3-dimethylbutanoyl)-N-[(1S)-1-phenylethyl]carbamate.
| Compound Name | benzyl N-(2-amino-3,3-dimethylbutanoyl)-N-[(1S)-1-phenylethyl]carbamate |
|---|---|
| PubChem CID | 57133848 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | benzyl N-(2-amino-3,3-dimethylbutanoyl)-N-[(1S)-1-phenylethyl]carbamate |
| SMILES | C[C@@H](c1ccccc1)N(C(=O)OCc1ccccc1)C(=O)C(N)C(C)(C)C |
| InChI | InChI=1S/C22H28N2O3/c1-16(18-13-9-6-10-14-18)24(20(25)19(23)22(2,3)4)21(26)27-15-17-11-7-5-8-12-17/h5-14,16,19H,15,23H2,1-4H3/t16-,19?/m0/s1 |
| InChIKey | URQTZGVIIIOFTM-UCFFOFKASA-N |
| XLogP | 4.29 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |