C24H32N2O3 — CID 70053306
tert-butyl N-[(2S)-2-amino-3,3-dimethylbutanoyl]-N-benzhydrylcarbamate (PubChem CID 70053306) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-amino-3,3-dimethylbutanoyl]-N-benzhydrylcarbamate.
| Compound Name | tert-butyl N-[(2S)-2-amino-3,3-dimethylbutanoyl]-N-benzhydrylcarbamate |
|---|---|
| PubChem CID | 70053306 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | tert-butyl N-[(2S)-2-amino-3,3-dimethylbutanoyl]-N-benzhydrylcarbamate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)[C@@H](N)C(C)(C)C)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H32N2O3/c1-23(2,3)20(25)21(27)26(22(28)29-24(4,5)6)19(17-13-9-7-10-14-17)18-15-11-8-12-16-18/h7-16,19-20H,25H2,1-6H3/t20-/m1/s1 |
| InChIKey | UOEUTDBWFLJJKW-HXUWFJFHSA-N |
| XLogP | 4.91 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |