C24H32N2O3 — CID 57224835
tert-butyl N-(2-aminohexanoyl)-N-benzhydrylcarbamate (PubChem CID 57224835) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is tert-butyl N-(2-aminohexanoyl)-N-benzhydrylcarbamate.
| Compound Name | tert-butyl N-(2-aminohexanoyl)-N-benzhydrylcarbamate |
|---|---|
| PubChem CID | 57224835 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | tert-butyl N-(2-aminohexanoyl)-N-benzhydrylcarbamate |
| SMILES | CCCCC(N)C(=O)N(C(=O)OC(C)(C)C)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H32N2O3/c1-5-6-17-20(25)22(27)26(23(28)29-24(2,3)4)21(18-13-9-7-10-14-18)19-15-11-8-12-16-19/h7-16,20-21H,5-6,17,25H2,1-4H3 |
| InChIKey | KUANJWQHKBQZIQ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |