C14H20N2O4 — CID 174607780
benzyl N-(1-amino-4-methyl-1-oxopentan-2-yl)-N-hydroxycarbamate (PubChem CID 174607780) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is benzyl N-(1-amino-4-methyl-1-oxopentan-2-yl)-N-hydroxycarbamate.
| Compound Name | benzyl N-(1-amino-4-methyl-1-oxopentan-2-yl)-N-hydroxycarbamate |
|---|---|
| PubChem CID | 174607780 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | benzyl N-(1-amino-4-methyl-1-oxopentan-2-yl)-N-hydroxycarbamate |
| SMILES | CC(C)CC(C(N)=O)N(O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H20N2O4/c1-10(2)8-12(13(15)17)16(19)14(18)20-9-11-6-4-3-5-7-11/h3-7,10,12,19H,8-9H2,1-2H3,(H2,15,17) |
| InChIKey | ICZNEQNDCRMPJM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|