C22H26BrNO3 — CID 122222125
methyl (2S)-2-[benzyl-(2-bromo-2-phenylacetyl)amino]-4-methylpentanoate (PubChem CID 122222125) has the molecular formula C22H26BrNO3 and a molecular weight of 432.36 g/mol. Its IUPAC name is methyl (2S)-2-[benzyl-(2-bromo-2-phenylacetyl)amino]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[benzyl-(2-bromo-2-phenylacetyl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 122222125 |
| Molecular Formula | C22H26BrNO3 |
| Molecular Weight | 432.36 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | methyl (2S)-2-[benzyl-(2-bromo-2-phenylacetyl)amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)N(Cc1ccccc1)C(=O)C(Br)c1ccccc1 |
| InChI | InChI=1S/C22H26BrNO3/c1-16(2)14-19(22(26)27-3)24(15-17-10-6-4-7-11-17)21(25)20(23)18-12-8-5-9-13-18/h4-13,16,19-20H,14-15H2,1-3H3/t19-,20?/m0/s1 |
| InChIKey | SXNWRQLFLVBPSC-XJDOXCRVSA-N |
| XLogP | 4.74 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.36 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|