C25H32N2O5 — CID 90946534
(2S)-2-[4-methylpentanoyl-[(2S)-1-oxo-1-(phenylmethoxyamino)propan-2-yl]amino]-3-phenylpropanoic acid (PubChem CID 90946534) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is (2S)-2-[4-methylpentanoyl-[(2S)-1-oxo-1-(phenylmethoxyamino)propan-2-yl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[4-methylpentanoyl-[(2S)-1-oxo-1-(phenylmethoxyamino)propan-2-yl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 90946534 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | (2S)-2-[4-methylpentanoyl-[(2S)-1-oxo-1-(phenylmethoxyamino)propan-2-yl]amino]-3-phenylpropanoic acid |
| SMILES | CC(C)CCC(=O)N([C@@H](C)C(=O)NOCc1ccccc1)[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C25H32N2O5/c1-18(2)14-15-23(28)27(22(25(30)31)16-20-10-6-4-7-11-20)19(3)24(29)26-32-17-21-12-8-5-9-13-21/h4-13,18-19,22H,14-17H2,1-3H3,(H,26,29)(H,30,31)/t19-,22-/m0/s1 |
| InChIKey | XYHMNZAQBJRYNZ-UGKGYDQZSA-N |
| XLogP | 3.58 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|