C38H51N5O8 — CID 86757303
tert-butyl (2S,3R)-3-[[2,4-dioxo-8-[2-(phenylmethoxycarbonylamino)acetyl]-1,3,8-triazaspiro[4.5]decan-3-yl]carbamoyl]-5-methyl-2-(3-phenylpropyl)hexanoate (PubChem CID 86757303) has the molecular formula C38H51N5O8 and a molecular weight of 705.85 g/mol. Its IUPAC name is tert-butyl (2S,3R)-3-[[2,4-dioxo-8-[2-(phenylmethoxycarbonylamino)acetyl]-1,3,8-triazaspiro[4.5]decan-3-yl]carbamoyl]-5-methyl-2-(3-phenylpropyl)hexanoate.
| Compound Name | tert-butyl (2S,3R)-3-[[2,4-dioxo-8-[2-(phenylmethoxycarbonylamino)acetyl]-1,3,8-triazaspiro[4.5]decan-3-yl]carbamoyl]-5-methyl-2-(3-phenylpropyl)hexanoate |
|---|---|
| PubChem CID | 86757303 |
| Molecular Formula | C38H51N5O8 |
| Molecular Weight | 705.85 g/mol |
| Exact Mass | 705.37 |
| IUPAC Name | tert-butyl (2S,3R)-3-[[2,4-dioxo-8-[2-(phenylmethoxycarbonylamino)acetyl]-1,3,8-triazaspiro[4.5]decan-3-yl]carbamoyl]-5-methyl-2-(3-phenylpropyl)hexanoate |
| SMILES | CC(C)C[C@@H](C(=O)NN1C(=O)NC2(CCN(C(=O)CNC(=O)OCc3ccccc3)CC2)C1=O)[C@H](CCCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C38H51N5O8/c1-26(2)23-30(29(33(46)51-37(3,4)5)18-12-17-27-13-8-6-9-14-27)32(45)41-43-34(47)38(40-35(43)48)19-21-42(22-20-38)31(44)24-39-36(49)50-25-28-15-10-7-11-16-28/h6-11,13-16,26,29-30H,12,17-25H2,1-5H3,(H,39,49)(H,40,48)(H,41,45)/t29-,30+/m0/s1 |
| InChIKey | CFKBYOIJEGDFIT-XZWHSSHBSA-N |
| XLogP | 4.50 |
| TPSA | 163.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.85 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|