C23H36O7S — CID 87875360
4-O-benzyl 1-O-tert-butyl (2S,3R)-3-(2-methylpropyl)-2-(3-methylsulfonyloxypropyl)butanedioate (PubChem CID 87875360) has the molecular formula C23H36O7S and a molecular weight of 456.60 g/mol. Its IUPAC name is 4-O-benzyl 1-O-tert-butyl (2S,3R)-3-(2-methylpropyl)-2-(3-methylsulfonyloxypropyl)butanedioate.
| Compound Name | 4-O-benzyl 1-O-tert-butyl (2S,3R)-3-(2-methylpropyl)-2-(3-methylsulfonyloxypropyl)butanedioate |
|---|---|
| PubChem CID | 87875360 |
| Molecular Formula | C23H36O7S |
| Molecular Weight | 456.60 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 4-O-benzyl 1-O-tert-butyl (2S,3R)-3-(2-methylpropyl)-2-(3-methylsulfonyloxypropyl)butanedioate |
| SMILES | CC(C)C[C@@H](C(=O)OCc1ccccc1)[C@H](CCCOS(C)(=O)=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H36O7S/c1-17(2)15-20(21(24)28-16-18-11-8-7-9-12-18)19(22(25)30-23(3,4)5)13-10-14-29-31(6,26)27/h7-9,11-12,17,19-20H,10,13-16H2,1-6H3/t19-,20+/m0/s1 |
| InChIKey | TYRCAOQYYYAEJS-VQTJNVASSA-N |
| XLogP | 4.11 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.60 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|