C35H40O8 — CID 151930910
1-O,1-O,1-O-tribenzyl 2-O-tert-butyl (2R)-4-methylpentane-1,1,1,2-tetracarboxylate (PubChem CID 151930910) has the molecular formula C35H40O8 and a molecular weight of 588.70 g/mol. Its IUPAC name is 1-O,1-O,1-O-tribenzyl 2-O-tert-butyl (2R)-4-methylpentane-1,1,1,2-tetracarboxylate.
| Compound Name | 1-O,1-O,1-O-tribenzyl 2-O-tert-butyl (2R)-4-methylpentane-1,1,1,2-tetracarboxylate |
|---|---|
| PubChem CID | 151930910 |
| Molecular Formula | C35H40O8 |
| Molecular Weight | 588.70 g/mol |
| Exact Mass | 588.27 |
| IUPAC Name | 1-O,1-O,1-O-tribenzyl 2-O-tert-butyl (2R)-4-methylpentane-1,1,1,2-tetracarboxylate |
| SMILES | CC(C)C[C@@H](C(=O)OC(C)(C)C)C(C(=O)OCc1ccccc1)(C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C35H40O8/c1-25(2)21-29(30(36)43-34(3,4)5)35(31(37)40-22-26-15-9-6-10-16-26,32(38)41-23-27-17-11-7-12-18-27)33(39)42-24-28-19-13-8-14-20-28/h6-20,25,29H,21-24H2,1-5H3/t29-/m0/s1 |
| InChIKey | SYTPTZHLCCLIDA-LJAQVGFWSA-N |
| XLogP | 6.21 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.70 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|