C23H34O5 — CID 159950148
8-O-benzyl 1-O-tert-butyl (2R)-2-(2-methylpropyl)-4-oxooctanedioate (PubChem CID 159950148) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is 8-O-benzyl 1-O-tert-butyl (2R)-2-(2-methylpropyl)-4-oxooctanedioate.
| Compound Name | 8-O-benzyl 1-O-tert-butyl (2R)-2-(2-methylpropyl)-4-oxooctanedioate |
|---|---|
| PubChem CID | 159950148 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 8-O-benzyl 1-O-tert-butyl (2R)-2-(2-methylpropyl)-4-oxooctanedioate |
| SMILES | CC(C)CC(CC(=O)CCCC(=O)OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H34O5/c1-17(2)14-19(22(26)28-23(3,4)5)15-20(24)12-9-13-21(25)27-16-18-10-7-6-8-11-18/h6-8,10-11,17,19H,9,12-16H2,1-5H3 |
| InChIKey | OBZSODIXNXHPBK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |