C12H22O4 — CID 21222349
5-methyl-3-[(2-methylpropan-2-yl)oxycarbonyl]hexanoic acid (PubChem CID 21222349) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is 5-methyl-3-[(2-methylpropan-2-yl)oxycarbonyl]hexanoic acid.
| Compound Name | 5-methyl-3-[(2-methylpropan-2-yl)oxycarbonyl]hexanoic acid |
|---|---|
| PubChem CID | 21222349 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 5-methyl-3-[(2-methylpropan-2-yl)oxycarbonyl]hexanoic acid |
| SMILES | CC(C)CC(CC(=O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H22O4/c1-8(2)6-9(7-10(13)14)11(15)16-12(3,4)5/h8-9H,6-7H2,1-5H3,(H,13,14) |
| InChIKey | JJKFWWCBQZHDIA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |