C15H21NO5 — CID 151236321
3-O-benzyl 1-O-tert-butyl 2-amino-2-(hydroxymethyl)propanedioate (PubChem CID 151236321) has the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. Its IUPAC name is 3-O-benzyl 1-O-tert-butyl 2-amino-2-(hydroxymethyl)propanedioate.
| Compound Name | 3-O-benzyl 1-O-tert-butyl 2-amino-2-(hydroxymethyl)propanedioate |
|---|---|
| PubChem CID | 151236321 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 3-O-benzyl 1-O-tert-butyl 2-amino-2-(hydroxymethyl)propanedioate |
| SMILES | CC(C)(C)OC(=O)C(N)(CO)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H21NO5/c1-14(2,3)21-13(19)15(16,10-17)12(18)20-9-11-7-5-4-6-8-11/h4-8,17H,9-10,16H2,1-3H3 |
| InChIKey | NPIUXSAMGARSQC-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|