C20H25NO4 — CID 174448640
tert-butyl (2R)-2-amino-3-hydroxy-2-(4-phenylmethoxyphenyl)propanoate (PubChem CID 174448640) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is tert-butyl (2R)-2-amino-3-hydroxy-2-(4-phenylmethoxyphenyl)propanoate.
| Compound Name | tert-butyl (2R)-2-amino-3-hydroxy-2-(4-phenylmethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 174448640 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | tert-butyl (2R)-2-amino-3-hydroxy-2-(4-phenylmethoxyphenyl)propanoate |
| SMILES | CC(C)(C)OC(=O)[C@](N)(CO)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H25NO4/c1-19(2,3)25-18(23)20(21,14-22)16-9-11-17(12-10-16)24-13-15-7-5-4-6-8-15/h4-12,22H,13-14,21H2,1-3H3/t20-/m0/s1 |
| InChIKey | LOQCVQHOOCTHIL-FQEVSTJZSA-N |
| XLogP | 2.75 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |