C19H23NO3 — CID 134113096
N-methoxy-N,2-dimethyl-2-(4-phenylmethoxyphenyl)propanamide (PubChem CID 134113096) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-methoxy-N,2-dimethyl-2-(4-phenylmethoxyphenyl)propanamide.
| Compound Name | N-methoxy-N,2-dimethyl-2-(4-phenylmethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 134113096 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | N-methoxy-N,2-dimethyl-2-(4-phenylmethoxyphenyl)propanamide |
| SMILES | CON(C)C(=O)C(C)(C)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H23NO3/c1-19(2,18(21)20(3)22-4)16-10-12-17(13-11-16)23-14-15-8-6-5-7-9-15/h5-13H,14H2,1-4H3 |
| InChIKey | CFMUSCVGABJDME-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|