C19H24O4Si — CID 173241831
(2S)-2,3-dimethyl-3-(4-phenylmethoxyphenyl)-2-silyloxybutanoic acid (PubChem CID 173241831) has the molecular formula C19H24O4Si and a molecular weight of 344.48 g/mol. Its IUPAC name is (2S)-2,3-dimethyl-3-(4-phenylmethoxyphenyl)-2-silyloxybutanoic acid.
| Compound Name | (2S)-2,3-dimethyl-3-(4-phenylmethoxyphenyl)-2-silyloxybutanoic acid |
|---|---|
| PubChem CID | 173241831 |
| Molecular Formula | C19H24O4Si |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | (2S)-2,3-dimethyl-3-(4-phenylmethoxyphenyl)-2-silyloxybutanoic acid |
| SMILES | CC(C)(c1ccc(OCc2ccccc2)cc1)[C@](C)(O[SiH3])C(=O)O |
| InChI | InChI=1S/C19H24O4Si/c1-18(2,19(3,23-24)17(20)21)15-9-11-16(12-10-15)22-13-14-7-5-4-6-8-14/h4-12H,13H2,1-3,24H3,(H,20,21)/t19-/m1/s1 |
| InChIKey | YHUBCJSBGJDDQA-LJQANCHMSA-N |
| XLogP | 2.68 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|