C21H33NO4 — CID 54031190
4-O-benzyl 1-O-tert-butyl 3-(methylaminomethyl)-2-(2-methylpropyl)butanedioate (PubChem CID 54031190) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is 4-O-benzyl 1-O-tert-butyl 3-(methylaminomethyl)-2-(2-methylpropyl)butanedioate.
| Compound Name | 4-O-benzyl 1-O-tert-butyl 3-(methylaminomethyl)-2-(2-methylpropyl)butanedioate |
|---|---|
| PubChem CID | 54031190 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 4-O-benzyl 1-O-tert-butyl 3-(methylaminomethyl)-2-(2-methylpropyl)butanedioate |
| SMILES | CNCC(C(=O)OCc1ccccc1)C(CC(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H33NO4/c1-15(2)12-17(20(24)26-21(3,4)5)18(13-22-6)19(23)25-14-16-10-8-7-9-11-16/h7-11,15,17-18,22H,12-14H2,1-6H3 |
| InChIKey | LFSIHMAWDDYHLA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |