C28H33NO6 — CID 70070887
4-O-benzyl 1-O-tert-butyl 3-[(1,3-dioxoisoindol-2-yl)methyl]-2-(2-methylpropyl)butanedioate (PubChem CID 70070887) has the molecular formula C28H33NO6 and a molecular weight of 479.57 g/mol. Its IUPAC name is 4-O-benzyl 1-O-tert-butyl 3-[(1,3-dioxoisoindol-2-yl)methyl]-2-(2-methylpropyl)butanedioate.
| Compound Name | 4-O-benzyl 1-O-tert-butyl 3-[(1,3-dioxoisoindol-2-yl)methyl]-2-(2-methylpropyl)butanedioate |
|---|---|
| PubChem CID | 70070887 |
| Molecular Formula | C28H33NO6 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | 4-O-benzyl 1-O-tert-butyl 3-[(1,3-dioxoisoindol-2-yl)methyl]-2-(2-methylpropyl)butanedioate |
| SMILES | CC(C)CC(C(=O)OC(C)(C)C)C(CN1C(=O)c2ccccc2C1=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H33NO6/c1-18(2)15-22(27(33)35-28(3,4)5)23(26(32)34-17-19-11-7-6-8-12-19)16-29-24(30)20-13-9-10-14-21(20)25(29)31/h6-14,18,22-23H,15-17H2,1-5H3 |
| InChIKey | IEVLYUDPUXBMLP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|