C25H29N3O6 — CID 71158518
benzyl N-[(2R)-1-(1,3-dioxoisoindol-2-yl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]butan-2-yl]carbamate (PubChem CID 71158518) has the molecular formula C25H29N3O6 and a molecular weight of 467.52 g/mol. Its IUPAC name is benzyl N-[(2R)-1-(1,3-dioxoisoindol-2-yl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]butan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R)-1-(1,3-dioxoisoindol-2-yl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 71158518 |
| Molecular Formula | C25H29N3O6 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | benzyl N-[(2R)-1-(1,3-dioxoisoindol-2-yl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]butan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC[C@H](CN1C(=O)c2ccccc2C1=O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H29N3O6/c1-25(2,3)34-23(31)26-14-13-18(27-24(32)33-16-17-9-5-4-6-10-17)15-28-21(29)19-11-7-8-12-20(19)22(28)30/h4-12,18H,13-16H2,1-3H3,(H,26,31)(H,27,32)/t18-/m1/s1 |
| InChIKey | YBHXEWVYBDFOCB-GOSISDBHSA-N |
| XLogP | 3.49 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|