C25H30O6 — CID 150763535
3-ethyl-4,4-dimethyl-2,2-bis(phenylmethoxycarbonyl)pentanoic acid (PubChem CID 150763535) has the molecular formula C25H30O6 and a molecular weight of 426.51 g/mol. Its IUPAC name is 3-ethyl-4,4-dimethyl-2,2-bis(phenylmethoxycarbonyl)pentanoic acid.
| Compound Name | 3-ethyl-4,4-dimethyl-2,2-bis(phenylmethoxycarbonyl)pentanoic acid |
|---|---|
| PubChem CID | 150763535 |
| Molecular Formula | C25H30O6 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 3-ethyl-4,4-dimethyl-2,2-bis(phenylmethoxycarbonyl)pentanoic acid |
| SMILES | CCC(C(C)(C)C)C(C(=O)O)(C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H30O6/c1-5-20(24(2,3)4)25(21(26)27,22(28)30-16-18-12-8-6-9-13-18)23(29)31-17-19-14-10-7-11-15-19/h6-15,20H,5,16-17H2,1-4H3,(H,26,27) |
| InChIKey | JYIJYZOHNBOSTG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|