C12H22O7S — CID 57323674
(2S,3R)-2-(2-methylpropyl)-3-(3-methylsulfonyloxypropyl)butanedioic acid (PubChem CID 57323674) has the molecular formula C12H22O7S and a molecular weight of 310.37 g/mol. Its IUPAC name is (2S,3R)-2-(2-methylpropyl)-3-(3-methylsulfonyloxypropyl)butanedioic acid.
| Compound Name | (2S,3R)-2-(2-methylpropyl)-3-(3-methylsulfonyloxypropyl)butanedioic acid |
|---|---|
| PubChem CID | 57323674 |
| Molecular Formula | C12H22O7S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | (2S,3R)-2-(2-methylpropyl)-3-(3-methylsulfonyloxypropyl)butanedioic acid |
| SMILES | CC(C)CC(C(=O)O)[C@@H](CCCOS(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C12H22O7S/c1-8(2)7-10(12(15)16)9(11(13)14)5-4-6-19-20(3,17)18/h8-10H,4-7H2,1-3H3,(H,13,14)(H,15,16)/t9-,10?/m1/s1 |
| InChIKey | KVCSTSUANSGKIA-YHMJZVADSA-N |
| XLogP | 1.19 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|