C9H18O6S — CID 87961771
2-(1-hydroxy-2-methylsulfonyloxyethyl)hexanoic acid (PubChem CID 87961771) has the molecular formula C9H18O6S and a molecular weight of 254.30 g/mol. Its IUPAC name is 2-(1-hydroxy-2-methylsulfonyloxyethyl)hexanoic acid.
| Compound Name | 2-(1-hydroxy-2-methylsulfonyloxyethyl)hexanoic acid |
|---|---|
| PubChem CID | 87961771 |
| Molecular Formula | C9H18O6S |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 2-(1-hydroxy-2-methylsulfonyloxyethyl)hexanoic acid |
| SMILES | CCCCC(C(=O)O)C(O)COS(C)(=O)=O |
| InChI | InChI=1S/C9H18O6S/c1-3-4-5-7(9(11)12)8(10)6-15-16(2,13)14/h7-8,10H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | ZAXSLLNBXMQKRO-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|