C6H15ClNO7S2- — CID 159205538
[(2S)-2-amino-3-hydroxy-4-methylsulfonyloxybutyl] methanesulfonate chloride (PubChem CID 159205538) has the molecular formula C6H15ClNO7S2- and a molecular weight of 312.77 g/mol. Its IUPAC name is [(2S)-2-amino-3-hydroxy-4-methylsulfonyloxybutyl] methanesulfonate chloride.
| Compound Name | [(2S)-2-amino-3-hydroxy-4-methylsulfonyloxybutyl] methanesulfonate chloride |
|---|---|
| PubChem CID | 159205538 |
| Molecular Formula | C6H15ClNO7S2- |
| Molecular Weight | 312.77 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | [(2S)-2-amino-3-hydroxy-4-methylsulfonyloxybutyl] methanesulfonate chloride |
| SMILES | CS(=O)(=O)OCC(O)[C@@H](N)COS(C)(=O)=O.[Cl-] |
| InChI | InChI=1S/C6H15NO7S2.ClH/c1-15(9,10)13-3-5(7)6(8)4-14-16(2,11)12;/h5-6,8H,3-4,7H2,1-2H3;1H/p-1/t5-,6?;/m0./s1 |
| InChIKey | HWMCADRHYCYMES-GNVLWMSISA-M |
| XLogP | -5.37 |
| TPSA | 132.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.77 |
| LogP ≤ 5 | -5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|