C9H20O12S3 — CID 98534051
[(2R,3S,4R,5R)-2,3,5-trihydroxy-4,6-bis(methylsulfonyloxy)hexyl] methanesulfonate (PubChem CID 98534051) has the molecular formula C9H20O12S3 and a molecular weight of 416.45 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-2,3,5-trihydroxy-4,6-bis(methylsulfonyloxy)hexyl] methanesulfonate.
| Compound Name | [(2R,3S,4R,5R)-2,3,5-trihydroxy-4,6-bis(methylsulfonyloxy)hexyl] methanesulfonate |
|---|---|
| PubChem CID | 98534051 |
| Molecular Formula | C9H20O12S3 |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | [(2R,3S,4R,5R)-2,3,5-trihydroxy-4,6-bis(methylsulfonyloxy)hexyl] methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@@H](O)[C@H](O)[C@H](OS(C)(=O)=O)[C@H](O)COS(C)(=O)=O |
| InChI | InChI=1S/C9H20O12S3/c1-22(13,14)19-4-6(10)8(12)9(21-24(3,17)18)7(11)5-20-23(2,15)16/h6-12H,4-5H2,1-3H3/t6-,7-,8+,9-/m1/s1 |
| InChIKey | MFOPJKLJJZBKRD-LURQLKTLSA-N |
| XLogP | -3.63 |
| TPSA | 190.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | -3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|