C11H22O8S2 — CID 140990672
[(2S,3R)-4-cyclopentyl-2,3-dihydroxy-4-methylsulfonyloxybutyl] methanesulfonate (PubChem CID 140990672) has the molecular formula C11H22O8S2 and a molecular weight of 346.42 g/mol. Its IUPAC name is [(2S,3R)-4-cyclopentyl-2,3-dihydroxy-4-methylsulfonyloxybutyl] methanesulfonate.
| Compound Name | [(2S,3R)-4-cyclopentyl-2,3-dihydroxy-4-methylsulfonyloxybutyl] methanesulfonate |
|---|---|
| PubChem CID | 140990672 |
| Molecular Formula | C11H22O8S2 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | [(2S,3R)-4-cyclopentyl-2,3-dihydroxy-4-methylsulfonyloxybutyl] methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@H](O)[C@@H](O)C(OS(C)(=O)=O)C1CCCC1 |
| InChI | InChI=1S/C11H22O8S2/c1-20(14,15)18-7-9(12)10(13)11(19-21(2,16)17)8-5-3-4-6-8/h8-13H,3-7H2,1-2H3/t9-,10+,11?/m0/s1 |
| InChIKey | HDTBKNSLEIRDJY-MTULOOOASA-N |
| XLogP | -0.78 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|