C17H32O6S2 — CID 10786947
[(1R,3R)-1,3-dicyclohexyl-3-methylsulfonyloxypropyl] methanesulfonate (PubChem CID 10786947) has the molecular formula C17H32O6S2 and a molecular weight of 396.57 g/mol. Its IUPAC name is [(1R,3R)-1,3-dicyclohexyl-3-methylsulfonyloxypropyl] methanesulfonate.
| Compound Name | [(1R,3R)-1,3-dicyclohexyl-3-methylsulfonyloxypropyl] methanesulfonate |
|---|---|
| PubChem CID | 10786947 |
| Molecular Formula | C17H32O6S2 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | [(1R,3R)-1,3-dicyclohexyl-3-methylsulfonyloxypropyl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@H](C[C@@H](OS(C)(=O)=O)C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C17H32O6S2/c1-24(18,19)22-16(14-9-5-3-6-10-14)13-17(23-25(2,20)21)15-11-7-4-8-12-15/h14-17H,3-13H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | PMVHMZTXIYHZDA-IAGOWNOFSA-N |
| XLogP | 3.23 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|