C16H25NO3S — CID 177472282
(1-cyclohexyl-3-phenylbutyl) sulfamate (PubChem CID 177472282) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is (1-cyclohexyl-3-phenylbutyl) sulfamate.
| Compound Name | (1-cyclohexyl-3-phenylbutyl) sulfamate |
|---|---|
| PubChem CID | 177472282 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (1-cyclohexyl-3-phenylbutyl) sulfamate |
| SMILES | CC(CC(OS(N)(=O)=O)C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C16H25NO3S/c1-13(14-8-4-2-5-9-14)12-16(20-21(17,18)19)15-10-6-3-7-11-15/h2,4-5,8-9,13,15-16H,3,6-7,10-12H2,1H3,(H2,17,18,19) |
| InChIKey | UBBGJGMSBWRWBZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |