C23H46O2 — CID 90992156
4-cyclohexylpentan-2-ylbenzene;ethane;methanol (PubChem CID 90992156) has the molecular formula C23H46O2 and a molecular weight of 354.62 g/mol. Its IUPAC name is 4-cyclohexylpentan-2-ylbenzene;ethane;methanol.
| Compound Name | 4-cyclohexylpentan-2-ylbenzene;ethane;methanol |
|---|---|
| PubChem CID | 90992156 |
| Molecular Formula | C23H46O2 |
| Molecular Weight | 354.62 g/mol |
| Exact Mass | 354.35 |
| IUPAC Name | 4-cyclohexylpentan-2-ylbenzene;ethane;methanol |
| SMILES | CC.CC.CC(CC(C)C1CCCCC1)c1ccccc1.CO.CO |
| InChI | InChI=1S/C17H26.2C2H6.2CH4O/c1-14(16-9-5-3-6-10-16)13-15(2)17-11-7-4-8-12-17;4*1-2/h3,5-6,9-10,14-15,17H,4,7-8,11-13H2,1-2H3;2*1-2H3;2*2H,1H3 |
| InChIKey | LXCXRXLQAGJRES-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.62 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |