C19H30 — CID 23597687
5-cyclohexylheptan-2-ylbenzene (PubChem CID 23597687) has the molecular formula C19H30 and a molecular weight of 258.45 g/mol. Its IUPAC name is 5-cyclohexylheptan-2-ylbenzene.
| Compound Name | 5-cyclohexylheptan-2-ylbenzene |
|---|---|
| PubChem CID | 23597687 |
| Molecular Formula | C19H30 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | 5-cyclohexylheptan-2-ylbenzene |
| SMILES | CCC(CCC(C)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C19H30/c1-3-17(19-12-8-5-9-13-19)15-14-16(2)18-10-6-4-7-11-18/h4,6-7,10-11,16-17,19H,3,5,8-9,12-15H2,1-2H3 |
| InChIKey | VUGCCAHNQJQWKU-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |