About 5-cyclohexylheptan-2-ol
5-cyclohexylheptan-2-ol (PubChem CID 89364025) has the molecular formula C13H26O
and a molecular weight of 198.35 g/mol. Its IUPAC name is 5-cyclohexylheptan-2-ol.
Molecular Properties
| Compound Name | 5-cyclohexylheptan-2-ol |
| PubChem CID | 89364025 |
| Molecular Formula | C13H26O |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | 5-cyclohexylheptan-2-ol |
| SMILES | CCC(CCC(C)O)C1CCCCC1 |
| InChI | InChI=1S/C13H26O/c1-3-12(10-9-11(2)14)13-7-5-4-6-8-13/h11-14H,3-10H2,1-2H3 |
| InChIKey | KETBFOSOIRHCSP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-cyclohexylheptan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexylheptan-2-ol?
The IUPAC name of 5-cyclohexylheptan-2-ol (CID 89364025) is 5-cyclohexylheptan-2-ol.
What is the SMILES notation for 5-cyclohexylheptan-2-ol?
The canonical SMILES for 5-cyclohexylheptan-2-ol is CCC(CCC(C)O)C1CCCCC1.
What is the InChIKey of 5-cyclohexylheptan-2-ol?
The InChIKey is KETBFOSOIRHCSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O/c1-3-12(10-9-11(2)14)13-7-5-4-6-8-13/h11-14H,3-10H2,1-2H3.
What are the key properties of 5-cyclohexylheptan-2-ol?
5-cyclohexylheptan-2-ol has a molecular weight of 198.35 g/mol, XLogP of 3.75, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexylheptan-2-ol is sourced from PubChem (CID 89364025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).