C20H32O2 — CID 158475695
[cyclohexyl(phenyl)methyl] 2-methylpropanoate;propane (PubChem CID 158475695) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is [cyclohexyl(phenyl)methyl] 2-methylpropanoate;propane.
| Compound Name | [cyclohexyl(phenyl)methyl] 2-methylpropanoate;propane |
|---|---|
| PubChem CID | 158475695 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | [cyclohexyl(phenyl)methyl] 2-methylpropanoate;propane |
| SMILES | CC(C)C(=O)OC(c1ccccc1)C1CCCCC1.CCC |
| InChI | InChI=1S/C17H24O2.C3H8/c1-13(2)17(18)19-16(14-9-5-3-6-10-14)15-11-7-4-8-12-15;1-3-2/h3,5-6,9-10,13,15-16H,4,7-8,11-12H2,1-2H3;3H2,1-2H3 |
| InChIKey | HGXCKKDJZVUHSY-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |