C17H25NO2 — CID 154718412
[cyclopropyl(phenyl)methyl] N,N-di(propan-2-yl)carbamate (PubChem CID 154718412) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is [cyclopropyl(phenyl)methyl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [cyclopropyl(phenyl)methyl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 154718412 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | [cyclopropyl(phenyl)methyl] N,N-di(propan-2-yl)carbamate |
| SMILES | CC(C)N(C(=O)OC(c1ccccc1)C1CC1)C(C)C |
| InChI | InChI=1S/C17H25NO2/c1-12(2)18(13(3)4)17(19)20-16(15-10-11-15)14-8-6-5-7-9-14/h5-9,12-13,15-16H,10-11H2,1-4H3 |
| InChIKey | NYHDXWMJNMQWOO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |