C15H23NO — CID 15064517
(2R)-2-phenyl-N,N-di(propan-2-yl)propanamide (PubChem CID 15064517) has the molecular formula C15H23NO and a molecular weight of 233.36 g/mol. Its IUPAC name is (2R)-2-phenyl-N,N-di(propan-2-yl)propanamide.
| Compound Name | (2R)-2-phenyl-N,N-di(propan-2-yl)propanamide |
|---|---|
| PubChem CID | 15064517 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | (2R)-2-phenyl-N,N-di(propan-2-yl)propanamide |
| SMILES | CC(C)N(C(=O)[C@H](C)c1ccccc1)C(C)C |
| InChI | InChI=1S/C15H23NO/c1-11(2)16(12(3)4)15(17)13(5)14-9-7-6-8-10-14/h6-13H,1-5H3/t13-/m1/s1 |
| InChIKey | NFGWRXUMUOYNAM-CYBMUJFWSA-N |
| XLogP | 3.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |