C27H32N2O — CID 101028936
(2R,3S)-3-anilino-2,3-diphenyl-N,N-di(propan-2-yl)propanamide (PubChem CID 101028936) has the molecular formula C27H32N2O and a molecular weight of 400.57 g/mol. Its IUPAC name is (2R,3S)-3-anilino-2,3-diphenyl-N,N-di(propan-2-yl)propanamide.
| Compound Name | (2R,3S)-3-anilino-2,3-diphenyl-N,N-di(propan-2-yl)propanamide |
|---|---|
| PubChem CID | 101028936 |
| Molecular Formula | C27H32N2O |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | (2R,3S)-3-anilino-2,3-diphenyl-N,N-di(propan-2-yl)propanamide |
| SMILES | CC(C)N(C(=O)[C@H](c1ccccc1)[C@H](Nc1ccccc1)c1ccccc1)C(C)C |
| InChI | InChI=1S/C27H32N2O/c1-20(2)29(21(3)4)27(30)25(22-14-8-5-9-15-22)26(23-16-10-6-11-17-23)28-24-18-12-7-13-19-24/h5-21,25-26,28H,1-4H3/t25-,26-/m1/s1 |
| InChIKey | CQRLFNDIOSWAKW-CLJLJLNGSA-N |
| XLogP | 6.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |