C27H26N2O — CID 101028938
(2R,3S)-N,N-dimethyl-3-(naphthalen-2-ylamino)-2,3-diphenylpropanamide (PubChem CID 101028938) has the molecular formula C27H26N2O and a molecular weight of 394.52 g/mol. Its IUPAC name is (2R,3S)-N,N-dimethyl-3-(naphthalen-2-ylamino)-2,3-diphenylpropanamide.
| Compound Name | (2R,3S)-N,N-dimethyl-3-(naphthalen-2-ylamino)-2,3-diphenylpropanamide |
|---|---|
| PubChem CID | 101028938 |
| Molecular Formula | C27H26N2O |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | (2R,3S)-N,N-dimethyl-3-(naphthalen-2-ylamino)-2,3-diphenylpropanamide |
| SMILES | CN(C)C(=O)[C@H](c1ccccc1)[C@H](Nc1ccc2ccccc2c1)c1ccccc1 |
| InChI | InChI=1S/C27H26N2O/c1-29(2)27(30)25(21-12-5-3-6-13-21)26(22-14-7-4-8-15-22)28-24-18-17-20-11-9-10-16-23(20)19-24/h3-19,25-26,28H,1-2H3/t25-,26-/m1/s1 |
| InChIKey | UHWDZYXDCPMAJY-CLJLJLNGSA-N |
| XLogP | 5.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |