C32H36N2O2S — CID 89402051
bis(N,N-dimethyl-2,2-diphenylacetamide);sulfane (PubChem CID 89402051) has the molecular formula C32H36N2O2S and a molecular weight of 512.72 g/mol. Its IUPAC name is bis(N,N-dimethyl-2,2-diphenylacetamide);sulfane.
| Compound Name | bis(N,N-dimethyl-2,2-diphenylacetamide);sulfane |
|---|---|
| PubChem CID | 89402051 |
| Molecular Formula | C32H36N2O2S |
| Molecular Weight | 512.72 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | bis(N,N-dimethyl-2,2-diphenylacetamide);sulfane |
| SMILES | CN(C)C(=O)C(c1ccccc1)c1ccccc1.CN(C)C(=O)C(c1ccccc1)c1ccccc1.S |
| InChI | InChI=1S/2C16H17NO.H2S/c2*1-17(2)16(18)15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;/h2*3-12,15H,1-2H3;1H2 |
| InChIKey | NBDLPWZECYALLS-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.72 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |