C20H17NO2 — CID 23854752
N-hydroxy-N,2,2-triphenylacetamide (PubChem CID 23854752) has the molecular formula C20H17NO2 and a molecular weight of 303.36 g/mol. Its IUPAC name is N-hydroxy-N,2,2-triphenylacetamide.
| Compound Name | N-hydroxy-N,2,2-triphenylacetamide |
|---|---|
| PubChem CID | 23854752 |
| Molecular Formula | C20H17NO2 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | N-hydroxy-N,2,2-triphenylacetamide |
| SMILES | O=C(C(c1ccccc1)c1ccccc1)N(O)c1ccccc1 |
| InChI | InChI=1S/C20H17NO2/c22-20(21(23)18-14-8-3-9-15-18)19(16-10-4-1-5-11-16)17-12-6-2-7-13-17/h1-15,19,23H |
| InChIKey | BZVYAGATBVLNKF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|