C15H15NO4S — CID 174462025
(2,2-diphenylacetyl)-methylsulfamic acid (PubChem CID 174462025) has the molecular formula C15H15NO4S and a molecular weight of 305.36 g/mol. Its IUPAC name is (2,2-diphenylacetyl)-methylsulfamic acid.
| Compound Name | (2,2-diphenylacetyl)-methylsulfamic acid |
|---|---|
| PubChem CID | 174462025 |
| Molecular Formula | C15H15NO4S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | (2,2-diphenylacetyl)-methylsulfamic acid |
| SMILES | CN(C(=O)C(c1ccccc1)c1ccccc1)S(=O)(=O)O |
| InChI | InChI=1S/C15H15NO4S/c1-16(21(18,19)20)15(17)14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11,14H,1H3,(H,18,19,20) |
| InChIKey | TVPMSECJFPYMAC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|